C30H42BrN3O3 — CID 67498767
[9-[6-[(4-bromophenyl)methylamino]hexyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid (PubChem CID 67498767) has the molecular formula C30H42BrN3O3 and a molecular weight of 572.59 g/mol. Its IUPAC name is [9-[6-[(4-bromophenyl)methylamino]hexyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid.
| Compound Name | [9-[6-[(4-bromophenyl)methylamino]hexyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid |
|---|---|
| PubChem CID | 67498767 |
| Molecular Formula | C30H42BrN3O3 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | [9-[6-[(4-bromophenyl)methylamino]hexyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid |
| SMILES | COc1ccc(C)cc1N(C(=O)O)C1CC2CCCC(C1)N2CCCCCCNCc1ccc(Br)cc1 |
| InChI | InChI=1S/C30H42BrN3O3/c1-22-10-15-29(37-2)28(18-22)34(30(35)36)27-19-25-8-7-9-26(20-27)33(25)17-6-4-3-5-16-32-21-23-11-13-24(31)14-12-23/h10-15,18,25-27,32H,3-9,16-17,19-21H2,1-2H3,(H,35,36) |
| InChIKey | TTXZGQYRGGYHRL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|