C30H40FN3O7 — CID 67498270
[9-[4-[(3-fluorophenyl)methylamino]butyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;oxalic acid (PubChem CID 67498270) has the molecular formula C30H40FN3O7 and a molecular weight of 573.66 g/mol. Its IUPAC name is [9-[4-[(3-fluorophenyl)methylamino]butyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;oxalic acid.
| Compound Name | [9-[4-[(3-fluorophenyl)methylamino]butyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;oxalic acid |
|---|---|
| PubChem CID | 67498270 |
| Molecular Formula | C30H40FN3O7 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | [9-[4-[(3-fluorophenyl)methylamino]butyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;oxalic acid |
| SMILES | COc1ccc(C)cc1N(C(=O)O)C1CC2CCCC(C1)N2CCCCNCc1cccc(F)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C28H38FN3O3.C2H2O4/c1-20-11-12-27(35-2)26(15-20)32(28(33)34)25-17-23-9-6-10-24(18-25)31(23)14-4-3-13-30-19-21-7-5-8-22(29)16-21;3-1(4)2(5)6/h5,7-8,11-12,15-16,23-25,30H,3-4,6,9-10,13-14,17-19H2,1-2H3,(H,33,34);(H,3,4)(H,5,6) |
| InChIKey | YOQLMXJGTNYALD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 139.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|