C32H44BrN3O7 — CID 67498134
[9-[6-[(3-bromophenyl)methylamino]hexyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;oxalic acid (PubChem CID 67498134) has the molecular formula C32H44BrN3O7 and a molecular weight of 662.62 g/mol. Its IUPAC name is [9-[6-[(3-bromophenyl)methylamino]hexyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;oxalic acid.
| Compound Name | [9-[6-[(3-bromophenyl)methylamino]hexyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;oxalic acid |
|---|---|
| PubChem CID | 67498134 |
| Molecular Formula | C32H44BrN3O7 |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 661.24 |
| IUPAC Name | [9-[6-[(3-bromophenyl)methylamino]hexyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;oxalic acid |
| SMILES | COc1ccc(C)cc1N(C(=O)O)C1CC2CCCC(C1)N2CCCCCCNCc1cccc(Br)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C30H42BrN3O3.C2H2O4/c1-22-13-14-29(37-2)28(17-22)34(30(35)36)27-19-25-11-8-12-26(20-27)33(25)16-6-4-3-5-15-32-21-23-9-7-10-24(31)18-23;3-1(4)2(5)6/h7,9-10,13-14,17-18,25-27,32H,3-6,8,11-12,15-16,19-21H2,1-2H3,(H,35,36);(H,3,4)(H,5,6) |
| InChIKey | ZXIUMTMXVSVYOO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 139.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|