C28H38FN3O3 — CID 67498927
[9-[4-[(4-fluorophenyl)methylamino]butyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid (PubChem CID 67498927) has the molecular formula C28H38FN3O3 and a molecular weight of 483.63 g/mol. Its IUPAC name is [9-[4-[(4-fluorophenyl)methylamino]butyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid.
| Compound Name | [9-[4-[(4-fluorophenyl)methylamino]butyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid |
|---|---|
| PubChem CID | 67498927 |
| Molecular Formula | C28H38FN3O3 |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | [9-[4-[(4-fluorophenyl)methylamino]butyl]-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid |
| SMILES | COc1ccc(C)cc1N(C(=O)O)C1CC2CCCC(C1)N2CCCCNCc1ccc(F)cc1 |
| InChI | InChI=1S/C28H38FN3O3/c1-20-8-13-27(35-2)26(16-20)32(28(33)34)25-17-23-6-5-7-24(18-25)31(23)15-4-3-14-30-19-21-9-11-22(29)12-10-21/h8-13,16,23-25,30H,3-7,14-15,17-19H2,1-2H3,(H,33,34) |
| InChIKey | YYUAEUPWRAVSTA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|