C21H34ClN3O3 — CID 67499299
[9-(4-aminobutyl)-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;hydrochloride (PubChem CID 67499299) has the molecular formula C21H34ClN3O3 and a molecular weight of 411.97 g/mol. Its IUPAC name is [9-(4-aminobutyl)-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;hydrochloride.
| Compound Name | [9-(4-aminobutyl)-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;hydrochloride |
|---|---|
| PubChem CID | 67499299 |
| Molecular Formula | C21H34ClN3O3 |
| Molecular Weight | 411.97 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | [9-(4-aminobutyl)-9-azabicyclo[3.3.1]nonan-3-yl]-(2-methoxy-5-methylphenyl)carbamic acid;hydrochloride |
| SMILES | COc1ccc(C)cc1N(C(=O)O)C1CC2CCCC(C1)N2CCCCN.Cl |
| InChI | InChI=1S/C21H33N3O3.ClH/c1-15-8-9-20(27-2)19(12-15)24(21(25)26)18-13-16-6-5-7-17(14-18)23(16)11-4-3-10-22;/h8-9,12,16-18H,3-7,10-11,13-14,22H2,1-2H3,(H,25,26);1H |
| InChIKey | PGDWXHXIPQJTHH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.97 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|