C25H23ClF3N5O2 — CID 67502705
2-(2-chloro-6-methylanilino)-7,7-dimethyl-N-[5-(trifluoromethyl)-2-pyridinyl]-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 67502705) has the molecular formula C25H23ClF3N5O2 and a molecular weight of 517.94 g/mol. Its IUPAC name is 2-(2-chloro-6-methylanilino)-7,7-dimethyl-N-[5-(trifluoromethyl)-2-pyridinyl]-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2-chloro-6-methylanilino)-7,7-dimethyl-N-[5-(trifluoromethyl)-2-pyridinyl]-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67502705 |
| Molecular Formula | C25H23ClF3N5O2 |
| Molecular Weight | 517.94 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 2-(2-chloro-6-methylanilino)-7,7-dimethyl-N-[5-(trifluoromethyl)-2-pyridinyl]-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | Cc1cccc(Cl)c1NC1Nc2cc(C(=O)Nc3ccc(C(F)(F)F)cn3)c3c(c2N1)CC(C)(C)O3 |
| InChI | InChI=1S/C25H23ClF3N5O2/c1-12-5-4-6-16(26)19(12)33-23-31-17-9-14(21-15(20(17)34-23)10-24(2,3)36-21)22(35)32-18-8-7-13(11-30-18)25(27,28)29/h4-9,11,23,31,33-34H,10H2,1-3H3,(H,30,32,35) |
| InChIKey | RANGDHFLCLRVPA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.94 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|