C38H34N6O2 — CID 67515909
tert-butyl-[1-[4-(4-quinolin-6-yl-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamic acid (PubChem CID 67515909) has the molecular formula C38H34N6O2 and a molecular weight of 606.73 g/mol. Its IUPAC name is tert-butyl-[1-[4-(4-quinolin-6-yl-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamic acid.
| Compound Name | tert-butyl-[1-[4-(4-quinolin-6-yl-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 67515909 |
| Molecular Formula | C38H34N6O2 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | tert-butyl-[1-[4-(4-quinolin-6-yl-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1(c2ccc(-c3c(-c4ccc5ncccc5c4)nc4n3-c3cccnc3Nc3ccccc3-4)cc2)CCC1 |
| InChI | InChI=1S/C38H34N6O2/c1-37(2,3)44(36(45)46)38(19-8-20-38)27-16-13-24(14-17-27)33-32(26-15-18-29-25(23-26)9-6-21-39-29)42-35-28-10-4-5-11-30(28)41-34-31(43(33)35)12-7-22-40-34/h4-7,9-18,21-23H,8,19-20H2,1-3H3,(H,40,41)(H,45,46) |
| InChIKey | ADCXBRNICXBHGG-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |