C33H63NO2 — CID 67517088
(3S,4S)-3-(3,7-dimethyloctoxy)-1-methyl-4-[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine (PubChem CID 67517088) has the molecular formula C33H63NO2 and a molecular weight of 505.87 g/mol. Its IUPAC name is (3S,4S)-3-(3,7-dimethyloctoxy)-1-methyl-4-[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine.
| Compound Name | (3S,4S)-3-(3,7-dimethyloctoxy)-1-methyl-4-[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine |
|---|---|
| PubChem CID | 67517088 |
| Molecular Formula | C33H63NO2 |
| Molecular Weight | 505.87 g/mol |
| Exact Mass | 505.49 |
| IUPAC Name | (3S,4S)-3-(3,7-dimethyloctoxy)-1-methyl-4-[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@H]1CN(C)C[C@@H]1OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C33H63NO2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-35-32-28-34(5)29-33(32)36-27-25-31(4)24-22-23-30(2)3/h10-11,13-14,30-33H,6-9,12,15-29H2,1-5H3/b11-10-,14-13-/t31?,32-,33-/m0/s1 |
| InChIKey | CHKDOIWYNITJJV-OSINGJFPSA-N |
| XLogP | 9.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.87 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|