C38H33Cl2FN2O6S — CID 67518462
N-[[3-[[[4-(3,5-dichloro-2-hydroxyphenyl)-2,3-dioxobutyl]-[[4-(4-fluorophenoxy)phenyl]methyl]amino]methyl]phenyl]methyl]-4-methylbenzenesulfonamide (PubChem CID 67518462) has the molecular formula C38H33Cl2FN2O6S and a molecular weight of 735.66 g/mol. Its IUPAC name is N-[[3-[[[4-(3,5-dichloro-2-hydroxyphenyl)-2,3-dioxobutyl]-[[4-(4-fluorophenoxy)phenyl]methyl]amino]methyl]phenyl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[3-[[[4-(3,5-dichloro-2-hydroxyphenyl)-2,3-dioxobutyl]-[[4-(4-fluorophenoxy)phenyl]methyl]amino]methyl]phenyl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 67518462 |
| Molecular Formula | C38H33Cl2FN2O6S |
| Molecular Weight | 735.66 g/mol |
| Exact Mass | 734.14 |
| IUPAC Name | N-[[3-[[[4-(3,5-dichloro-2-hydroxyphenyl)-2,3-dioxobutyl]-[[4-(4-fluorophenoxy)phenyl]methyl]amino]methyl]phenyl]methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2cccc(CN(CC(=O)C(=O)Cc3cc(Cl)cc(Cl)c3O)Cc3ccc(Oc4ccc(F)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C38H33Cl2FN2O6S/c1-25-5-15-34(16-6-25)50(47,48)42-21-27-3-2-4-28(17-27)23-43(24-37(45)36(44)19-29-18-30(39)20-35(40)38(29)46)22-26-7-11-32(12-8-26)49-33-13-9-31(41)10-14-33/h2-18,20,42,46H,19,21-24H2,1H3 |
| InChIKey | JEXJISNYUIAFAX-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.66 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|