C22H25FN6O2 — CID 67526563
tert-butyl N-[11-[3-(aminomethyl)-5-fluorophenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-7-yl]-N-ethylcarbamate (PubChem CID 67526563) has the molecular formula C22H25FN6O2 and a molecular weight of 424.48 g/mol. Its IUPAC name is tert-butyl N-[11-[3-(aminomethyl)-5-fluorophenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-7-yl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[11-[3-(aminomethyl)-5-fluorophenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-7-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 67526563 |
| Molecular Formula | C22H25FN6O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | tert-butyl N-[11-[3-(aminomethyl)-5-fluorophenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-7-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)c1nc2[nH]c(-c3cc(F)cc(CN)c3)cc2c2nc[nH]c12 |
| InChI | InChI=1S/C22H25FN6O2/c1-5-29(21(30)31-22(2,3)4)20-18-17(25-11-26-18)15-9-16(27-19(15)28-20)13-6-12(10-24)7-14(23)8-13/h6-9,11H,5,10,24H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | YQQIJEWIXKILFQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |