C16H21NO2 — CID 67536022
N-benzyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-imine (PubChem CID 67536022) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-benzyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-imine.
| Compound Name | N-benzyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-imine |
|---|---|
| PubChem CID | 67536022 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-benzyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-imine |
| SMILES | CC1CC2(CC/C1=N\Cc1ccccc1)OCCO2 |
| InChI | InChI=1S/C16H21NO2/c1-13-11-16(18-9-10-19-16)8-7-15(13)17-12-14-5-3-2-4-6-14/h2-6,13H,7-12H2,1H3/b17-15+ |
| InChIKey | RGTSVDMLYHEFIK-BMRADRMJSA-N |
| XLogP | 3.19 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|