C32H27N3O5 — CID 67542534
benzyl N-[3-[2-[(1,3-dioxoisoindol-2-yl)methyl]-5-phenylanilino]-3-oxopropyl]carbamate (PubChem CID 67542534) has the molecular formula C32H27N3O5 and a molecular weight of 533.58 g/mol. Its IUPAC name is benzyl N-[3-[2-[(1,3-dioxoisoindol-2-yl)methyl]-5-phenylanilino]-3-oxopropyl]carbamate.
| Compound Name | benzyl N-[3-[2-[(1,3-dioxoisoindol-2-yl)methyl]-5-phenylanilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 67542534 |
| Molecular Formula | C32H27N3O5 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | benzyl N-[3-[2-[(1,3-dioxoisoindol-2-yl)methyl]-5-phenylanilino]-3-oxopropyl]carbamate |
| SMILES | O=C(CCNC(=O)OCc1ccccc1)Nc1cc(-c2ccccc2)ccc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H27N3O5/c36-29(17-18-33-32(39)40-21-22-9-3-1-4-10-22)34-28-19-24(23-11-5-2-6-12-23)15-16-25(28)20-35-30(37)26-13-7-8-14-27(26)31(35)38/h1-16,19H,17-18,20-21H2,(H,33,39)(H,34,36) |
| InChIKey | SHFFJVHXCGWXFW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|