C25H30N4O5 — CID 67551519
2-[4-amino-2-(hydroxymethyl)-3-methylphenyl]-7-methoxy-6-(2-morpholin-4-ylethoxy)quinoline-3-carboxamide (PubChem CID 67551519) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-[4-amino-2-(hydroxymethyl)-3-methylphenyl]-7-methoxy-6-(2-morpholin-4-ylethoxy)quinoline-3-carboxamide.
| Compound Name | 2-[4-amino-2-(hydroxymethyl)-3-methylphenyl]-7-methoxy-6-(2-morpholin-4-ylethoxy)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 67551519 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 2-[4-amino-2-(hydroxymethyl)-3-methylphenyl]-7-methoxy-6-(2-morpholin-4-ylethoxy)quinoline-3-carboxamide |
| SMILES | COc1cc2nc(-c3ccc(N)c(C)c3CO)c(C(N)=O)cc2cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C25H30N4O5/c1-15-19(14-30)17(3-4-20(15)26)24-18(25(27)31)11-16-12-23(22(32-2)13-21(16)28-24)34-10-7-29-5-8-33-9-6-29/h3-4,11-13,30H,5-10,14,26H2,1-2H3,(H2,27,31) |
| InChIKey | YERUJLPYKCQPMT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|