C6H8N4O2 — CID 67557157
4a,5,6,8a-tetrahydro-1H-pteridine-2,4-dione (PubChem CID 67557157) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is 4a,5,6,8a-tetrahydro-1H-pteridine-2,4-dione.
| Compound Name | 4a,5,6,8a-tetrahydro-1H-pteridine-2,4-dione |
|---|---|
| PubChem CID | 67557157 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 4a,5,6,8a-tetrahydro-1H-pteridine-2,4-dione |
| SMILES | O=C1NC(=O)C2NCC=NC2N1 |
| InChI | InChI=1S/C6H8N4O2/c11-5-3-4(8-2-1-7-3)9-6(12)10-5/h2-4,7H,1H2,(H2,9,10,11,12) |
| InChIKey | LAAXGKDXTKDJPB-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |