C16H12F3NOS2 — CID 67562247
6-ethoxy-2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazole-4-thiol (PubChem CID 67562247) has the molecular formula C16H12F3NOS2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 6-ethoxy-2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazole-4-thiol.
| Compound Name | 6-ethoxy-2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazole-4-thiol |
|---|---|
| PubChem CID | 67562247 |
| Molecular Formula | C16H12F3NOS2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 6-ethoxy-2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazole-4-thiol |
| SMILES | CCOc1cc(S)c2nc(-c3ccc(C(F)(F)F)cc3)sc2c1 |
| InChI | InChI=1S/C16H12F3NOS2/c1-2-21-11-7-12(22)14-13(8-11)23-15(20-14)9-3-5-10(6-4-9)16(17,18)19/h3-8,22H,2H2,1H3 |
| InChIKey | BJLOAQVXVOKBFX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|