C25H44O2Si — CID 67564262
6-[(4aR,5S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]-2-methylhept-3-yn-2-ol (PubChem CID 67564262) has the molecular formula C25H44O2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is 6-[(4aR,5S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]-2-methylhept-3-yn-2-ol.
| Compound Name | 6-[(4aR,5S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]-2-methylhept-3-yn-2-ol |
|---|---|
| PubChem CID | 67564262 |
| Molecular Formula | C25H44O2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | 6-[(4aR,5S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]-2-methylhept-3-yn-2-ol |
| SMILES | CC(CC#CC(C)(C)O)C1=CCC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C25H44O2Si/c1-19(13-11-17-24(5,6)26)20-14-10-15-21-22(16-12-18-25(20,21)7)27-28(8,9)23(2,3)4/h14,19,21-22,26H,10,12-13,15-16,18H2,1-9H3/t19?,21-,22-,25+/m0/s1 |
| InChIKey | GKAFKOCZJLJWGA-AZVULHPWSA-N |
| XLogP | 6.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|