C21H24ClN5O4S — CID 67564631
N-[[1-[4-(3-aminopyrrolidin-1-yl)-3-nitrophenyl]-6-oxopiperidin-3-yl]methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 67564631) has the molecular formula C21H24ClN5O4S and a molecular weight of 477.97 g/mol. Its IUPAC name is N-[[1-[4-(3-aminopyrrolidin-1-yl)-3-nitrophenyl]-6-oxopiperidin-3-yl]methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[[1-[4-(3-aminopyrrolidin-1-yl)-3-nitrophenyl]-6-oxopiperidin-3-yl]methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 67564631 |
| Molecular Formula | C21H24ClN5O4S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N-[[1-[4-(3-aminopyrrolidin-1-yl)-3-nitrophenyl]-6-oxopiperidin-3-yl]methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | NC1CCN(c2ccc(N3CC(CNC(=O)c4ccc(Cl)s4)CCC3=O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H24ClN5O4S/c22-19-5-4-18(32-19)21(29)24-10-13-1-6-20(28)26(11-13)15-2-3-16(17(9-15)27(30)31)25-8-7-14(23)12-25/h2-5,9,13-14H,1,6-8,10-12,23H2,(H,24,29) |
| InChIKey | RBCOBBVINUXBAC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|