C13H23NO2 — CID 67572684
(3S)-3-amino-4-cyclohexyl-1-cyclopropylbut-1-ene-1,2-diol (PubChem CID 67572684) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (3S)-3-amino-4-cyclohexyl-1-cyclopropylbut-1-ene-1,2-diol.
| Compound Name | (3S)-3-amino-4-cyclohexyl-1-cyclopropylbut-1-ene-1,2-diol |
|---|---|
| PubChem CID | 67572684 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (3S)-3-amino-4-cyclohexyl-1-cyclopropylbut-1-ene-1,2-diol |
| SMILES | N[C@@H](CC1CCCCC1)C(O)=C(O)C1CC1 |
| InChI | InChI=1S/C13H23NO2/c14-11(8-9-4-2-1-3-5-9)13(16)12(15)10-6-7-10/h9-11,15-16H,1-8,14H2/t11-/m0/s1 |
| InChIKey | QNOBUJAQKYHRTN-NSHDSACASA-N |
| XLogP | 3.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|