C21H24O5 — CID 67577745
2-[6-(1-hydroxy-3-phenylpropyl)-1,3-benzodioxol-5-yl]pentanoic acid (PubChem CID 67577745) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[6-(1-hydroxy-3-phenylpropyl)-1,3-benzodioxol-5-yl]pentanoic acid.
| Compound Name | 2-[6-(1-hydroxy-3-phenylpropyl)-1,3-benzodioxol-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 67577745 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-[6-(1-hydroxy-3-phenylpropyl)-1,3-benzodioxol-5-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)c1cc2c(cc1C(O)CCc1ccccc1)OCO2 |
| InChI | InChI=1S/C21H24O5/c1-2-6-15(21(23)24)16-11-19-20(26-13-25-19)12-17(16)18(22)10-9-14-7-4-3-5-8-14/h3-5,7-8,11-12,15,18,22H,2,6,9-10,13H2,1H3,(H,23,24) |
| InChIKey | GLYROBDVGLJJIK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |