C24H24N2O3 — CID 67577870
4-(4-benzylimidazol-1-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid (PubChem CID 67577870) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-(4-benzylimidazol-1-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid.
| Compound Name | 4-(4-benzylimidazol-1-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid |
|---|---|
| PubChem CID | 67577870 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-(4-benzylimidazol-1-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid |
| SMILES | O=C(O)C(=CCn1cnc(Cc2ccccc2)c1)Oc1cccc2c1CCCC2 |
| InChI | InChI=1S/C24H24N2O3/c27-24(28)23(29-22-12-6-10-19-9-4-5-11-21(19)22)13-14-26-16-20(25-17-26)15-18-7-2-1-3-8-18/h1-3,6-8,10,12-13,16-17H,4-5,9,11,14-15H2,(H,27,28) |
| InChIKey | UQVSXSZEHJDYSE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|