C30H27NO4 — CID 67577218
4-(3-benzhydryl-1,2-oxazol-5-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid (PubChem CID 67577218) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 4-(3-benzhydryl-1,2-oxazol-5-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid.
| Compound Name | 4-(3-benzhydryl-1,2-oxazol-5-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid |
|---|---|
| PubChem CID | 67577218 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 4-(3-benzhydryl-1,2-oxazol-5-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid |
| SMILES | O=C(O)C(=CCc1cc(C(c2ccccc2)c2ccccc2)no1)Oc1cccc2c1CCCC2 |
| InChI | InChI=1S/C30H27NO4/c32-30(33)28(34-27-17-9-15-21-10-7-8-16-25(21)27)19-18-24-20-26(31-35-24)29(22-11-3-1-4-12-22)23-13-5-2-6-14-23/h1-6,9,11-15,17,19-20,29H,7-8,10,16,18H2,(H,32,33) |
| InChIKey | HUEACFCPZDNHHQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|