C29H26N2O4 — CID 67577914
4-[2-[phenyl(pyridin-3-yl)methyl]-1,3-oxazol-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid (PubChem CID 67577914) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 4-[2-[phenyl(pyridin-3-yl)methyl]-1,3-oxazol-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid.
| Compound Name | 4-[2-[phenyl(pyridin-3-yl)methyl]-1,3-oxazol-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid |
|---|---|
| PubChem CID | 67577914 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 4-[2-[phenyl(pyridin-3-yl)methyl]-1,3-oxazol-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)but-2-enoic acid |
| SMILES | O=C(O)C(=CCc1coc(C(c2ccccc2)c2cccnc2)n1)Oc1cccc2c1CCCC2 |
| InChI | InChI=1S/C29H26N2O4/c32-29(33)26(35-25-14-6-11-20-8-4-5-13-24(20)25)16-15-23-19-34-28(31-23)27(21-9-2-1-3-10-21)22-12-7-17-30-18-22/h1-3,6-7,9-12,14,16-19,27H,4-5,8,13,15H2,(H,32,33) |
| InChIKey | RQEBYRCLBYLXKN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|