C28H28N4O3 — CID 67577135
5-[4-[imidazol-1-yl(phenyl)methyl]pyrazol-1-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pent-3-enoic acid (PubChem CID 67577135) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 5-[4-[imidazol-1-yl(phenyl)methyl]pyrazol-1-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pent-3-enoic acid.
| Compound Name | 5-[4-[imidazol-1-yl(phenyl)methyl]pyrazol-1-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pent-3-enoic acid |
|---|---|
| PubChem CID | 67577135 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 5-[4-[imidazol-1-yl(phenyl)methyl]pyrazol-1-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pent-3-enoic acid |
| SMILES | O=C(O)C(C=CCn1cc(C(c2ccccc2)n2ccnc2)cn1)Oc1cccc2c1CCCC2 |
| InChI | InChI=1S/C28H28N4O3/c33-28(34)26(35-25-13-6-11-21-8-4-5-12-24(21)25)14-7-16-32-19-23(18-30-32)27(31-17-15-29-20-31)22-9-2-1-3-10-22/h1-3,6-7,9-11,13-15,17-20,26-27H,4-5,8,12,16H2,(H,33,34) |
| InChIKey | KVEMVAHXMXGKFY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|