C34H39NO4 — CID 67578188
2-(3-benzoylphenyl)propanoic acid;(1R,9R)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 67578188) has the molecular formula C34H39NO4 and a molecular weight of 525.69 g/mol. Its IUPAC name is 2-(3-benzoylphenyl)propanoic acid;(1R,9R)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | 2-(3-benzoylphenyl)propanoic acid;(1R,9R)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 67578188 |
| Molecular Formula | C34H39NO4 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 2-(3-benzoylphenyl)propanoic acid;(1R,9R)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1.COc1ccc2c(c1)[C@@]13CCCCC1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C18H25NO.C16H14O3/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18;1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h6-7,12,15,17H,3-5,8-11H2,1-2H3;2-11H,1H3,(H,18,19)/t15?,17-,18-;/m1./s1 |
| InChIKey | ABIFMPKLFDFVOI-PPPSATIBSA-N |
| XLogP | 6.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |