C27H36N2O4 — CID 135372844
2-amino-3-(4-hydroxyphenyl)propanoic acid;(1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 135372844) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;(1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;(1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 135372844 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;(1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H](C2)N(C)CC3.NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C18H25NO.C9H11NO3/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18;10-8(9(12)13)5-6-1-3-7(11)4-2-6/h6-7,12,15,17H,3-5,8-11H2,1-2H3;1-4,8,11H,5,10H2,(H,12,13)/t15-,17+,18+;/m1./s1 |
| InChIKey | GNQAEASYIITDOZ-URVXVIKDSA-N |
| XLogP | 3.73 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |