C17H19NO4S — CID 67581124
1-hydroxy-4-(3-phenoxyphenyl)sulfonylpiperidine (PubChem CID 67581124) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-hydroxy-4-(3-phenoxyphenyl)sulfonylpiperidine.
| Compound Name | 1-hydroxy-4-(3-phenoxyphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 67581124 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-hydroxy-4-(3-phenoxyphenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1cccc(Oc2ccccc2)c1)C1CCN(O)CC1 |
| InChI | InChI=1S/C17H19NO4S/c19-18-11-9-16(10-12-18)23(20,21)17-8-4-7-15(13-17)22-14-5-2-1-3-6-14/h1-8,13,16,19H,9-12H2 |
| InChIKey | DYQCBOPDGZUQFK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |