C24H28F3N5O4 — CID 67583328
[3-(diaminomethylideneamino)-5-(trifluoromethyl)phenyl] (2S)-2-[3,3-dimethylbutanoyl(formamido)amino]-3-phenylpropanoate (PubChem CID 67583328) has the molecular formula C24H28F3N5O4 and a molecular weight of 507.51 g/mol. Its IUPAC name is [3-(diaminomethylideneamino)-5-(trifluoromethyl)phenyl] (2S)-2-[3,3-dimethylbutanoyl(formamido)amino]-3-phenylpropanoate.
| Compound Name | [3-(diaminomethylideneamino)-5-(trifluoromethyl)phenyl] (2S)-2-[3,3-dimethylbutanoyl(formamido)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 67583328 |
| Molecular Formula | C24H28F3N5O4 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | [3-(diaminomethylideneamino)-5-(trifluoromethyl)phenyl] (2S)-2-[3,3-dimethylbutanoyl(formamido)amino]-3-phenylpropanoate |
| SMILES | CC(C)(C)CC(=O)N(NC=O)[C@@H](Cc1ccccc1)C(=O)Oc1cc(N=C(N)N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H28F3N5O4/c1-23(2,3)13-20(34)32(30-14-33)19(9-15-7-5-4-6-8-15)21(35)36-18-11-16(24(25,26)27)10-17(12-18)31-22(28)29/h4-8,10-12,14,19H,9,13H2,1-3H3,(H,30,33)(H4,28,29,31)/t19-/m0/s1 |
| InChIKey | YCEOATZSUFYSKA-IBGZPJMESA-N |
| XLogP | 3.05 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|