C33H43N5O2 — CID 67595921
N-(1-benzhydrylpiperidin-4-yl)-2-(butylcarbamoylamino)-5-(dimethylamino)-3-methylbenzamide (PubChem CID 67595921) has the molecular formula C33H43N5O2 and a molecular weight of 541.74 g/mol. Its IUPAC name is N-(1-benzhydrylpiperidin-4-yl)-2-(butylcarbamoylamino)-5-(dimethylamino)-3-methylbenzamide.
| Compound Name | N-(1-benzhydrylpiperidin-4-yl)-2-(butylcarbamoylamino)-5-(dimethylamino)-3-methylbenzamide |
|---|---|
| PubChem CID | 67595921 |
| Molecular Formula | C33H43N5O2 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.34 |
| IUPAC Name | N-(1-benzhydrylpiperidin-4-yl)-2-(butylcarbamoylamino)-5-(dimethylamino)-3-methylbenzamide |
| SMILES | CCCCNC(=O)Nc1c(C)cc(N(C)C)cc1C(=O)NC1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H43N5O2/c1-5-6-19-34-33(40)36-30-24(2)22-28(37(3)4)23-29(30)32(39)35-27-17-20-38(21-18-27)31(25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-16,22-23,27,31H,5-6,17-21H2,1-4H3,(H,35,39)(H2,34,36,40) |
| InChIKey | FFNUEKSBOPPZED-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|