C47H52N2O5S — CID 67601544
methyl (2S)-4-methyl-2-[[4-[[3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-(tritylsulfanylmethyl)propyl]amino]-2-phenylbenzoyl]amino]pentanoate (PubChem CID 67601544) has the molecular formula C47H52N2O5S and a molecular weight of 757.01 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[[4-[[3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-(tritylsulfanylmethyl)propyl]amino]-2-phenylbenzoyl]amino]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[[4-[[3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-(tritylsulfanylmethyl)propyl]amino]-2-phenylbenzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 67601544 |
| Molecular Formula | C47H52N2O5S |
| Molecular Weight | 757.01 g/mol |
| Exact Mass | 756.36 |
| IUPAC Name | methyl (2S)-4-methyl-2-[[4-[[3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-(tritylsulfanylmethyl)propyl]amino]-2-phenylbenzoyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)c1ccc(NCC(CSC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)OC(C)(C)C)cc1-c1ccccc1 |
| InChI | InChI=1S/C47H52N2O5S/c1-33(2)29-42(45(52)53-6)49-43(50)40-28-27-39(30-41(40)34-19-11-7-12-20-34)48-31-35(44(51)54-46(3,4)5)32-55-47(36-21-13-8-14-22-36,37-23-15-9-16-24-37)38-25-17-10-18-26-38/h7-28,30,33,35,42,48H,29,31-32H2,1-6H3,(H,49,50)/t35?,42-/m0/s1 |
| InChIKey | NZPZNRHERVTCDT-LEKQVXNCSA-N |
| XLogP | 9.77 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.01 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|