C22H38N2O2 — CID 67601776
5-phenylpentyl N-(5-aminopentyl)-N-(2-methylbutan-2-yl)carbamate (PubChem CID 67601776) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 5-phenylpentyl N-(5-aminopentyl)-N-(2-methylbutan-2-yl)carbamate.
| Compound Name | 5-phenylpentyl N-(5-aminopentyl)-N-(2-methylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 67601776 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 5-phenylpentyl N-(5-aminopentyl)-N-(2-methylbutan-2-yl)carbamate |
| SMILES | CCC(C)(C)N(CCCCCN)C(=O)OCCCCCc1ccccc1 |
| InChI | InChI=1S/C22H38N2O2/c1-4-22(2,3)24(18-12-7-11-17-23)21(25)26-19-13-6-10-16-20-14-8-5-9-15-20/h5,8-9,14-15H,4,6-7,10-13,16-19,23H2,1-3H3 |
| InChIKey | FHKUZVCSTOBAQC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|