C23H32ClN3O2 — CID 67614626
4-cyano-N-[2-(dibutylamino)ethyl]-1-methoxynaphthalene-2-carboxamide;hydrochloride (PubChem CID 67614626) has the molecular formula C23H32ClN3O2 and a molecular weight of 417.98 g/mol. Its IUPAC name is 4-cyano-N-[2-(dibutylamino)ethyl]-1-methoxynaphthalene-2-carboxamide;hydrochloride.
| Compound Name | 4-cyano-N-[2-(dibutylamino)ethyl]-1-methoxynaphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67614626 |
| Molecular Formula | C23H32ClN3O2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4-cyano-N-[2-(dibutylamino)ethyl]-1-methoxynaphthalene-2-carboxamide;hydrochloride |
| SMILES | CCCCN(CCCC)CCNC(=O)c1cc(C#N)c2ccccc2c1OC.Cl |
| InChI | InChI=1S/C23H31N3O2.ClH/c1-4-6-13-26(14-7-5-2)15-12-25-23(27)21-16-18(17-24)19-10-8-9-11-20(19)22(21)28-3;/h8-11,16H,4-7,12-15H2,1-3H3,(H,25,27);1H |
| InChIKey | KJLZJZXGYPNCBR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |