C22H28N3O2+ — CID 86306119
N-[[(2R)-1-butylpyrrolidin-1-ium-2-yl]methyl]-4-cyano-1-methoxynaphthalene-2-carboxamide (PubChem CID 86306119) has the molecular formula C22H28N3O2+ and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[[(2R)-1-butylpyrrolidin-1-ium-2-yl]methyl]-4-cyano-1-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[[(2R)-1-butylpyrrolidin-1-ium-2-yl]methyl]-4-cyano-1-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 86306119 |
| Molecular Formula | C22H28N3O2+ |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-[[(2R)-1-butylpyrrolidin-1-ium-2-yl]methyl]-4-cyano-1-methoxynaphthalene-2-carboxamide |
| SMILES | CCCC[NH+]1CCC[C@@H]1CNC(=O)c1cc(C#N)c2ccccc2c1OC |
| InChI | InChI=1S/C22H27N3O2/c1-3-4-11-25-12-7-8-17(25)15-24-22(26)20-13-16(14-23)18-9-5-6-10-19(18)21(20)27-2/h5-6,9-10,13,17H,3-4,7-8,11-12,15H2,1-2H3,(H,24,26)/p+1/t17-/m1/s1 |
| InChIKey | IDZASIQMRGPBCQ-QGZVFWFLSA-O |
| XLogP | 2.30 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |