C18H32N8O2S2 — CID 67617205
4-amino-6-tert-butyl-3-ethylsulfanyl-1,2,4-triazin-5-one (PubChem CID 67617205) has the molecular formula C18H32N8O2S2 and a molecular weight of 456.64 g/mol. Its IUPAC name is 4-amino-6-tert-butyl-3-ethylsulfanyl-1,2,4-triazin-5-one.
| Compound Name | 4-amino-6-tert-butyl-3-ethylsulfanyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 67617205 |
| Molecular Formula | C18H32N8O2S2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 4-amino-6-tert-butyl-3-ethylsulfanyl-1,2,4-triazin-5-one |
| SMILES | CCSc1nnc(C(C)(C)C)c(=O)n1N.CCSc1nnc(C(C)(C)C)c(=O)n1N |
| InChI | InChI=1S/2C9H16N4OS/c2*1-5-15-8-12-11-6(9(2,3)4)7(14)13(8)10/h2*5,10H2,1-4H3 |
| InChIKey | SBBBIUKLPLZYJB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 147.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |