C7H14N6O — CID 55282066
4-amino-6-tert-butyl-3-hydrazinyl-1,2,4-triazin-5-one (PubChem CID 55282066) has the molecular formula C7H14N6O and a molecular weight of 198.23 g/mol. Its IUPAC name is 4-amino-6-tert-butyl-3-hydrazinyl-1,2,4-triazin-5-one.
| Compound Name | 4-amino-6-tert-butyl-3-hydrazinyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 55282066 |
| Molecular Formula | C7H14N6O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 4-amino-6-tert-butyl-3-hydrazinyl-1,2,4-triazin-5-one |
| SMILES | CC(C)(C)c1nnc(NN)n(N)c1=O |
| InChI | InChI=1S/C7H14N6O/c1-7(2,3)4-5(14)13(9)6(10-8)12-11-4/h8-9H2,1-3H3,(H,10,12) |
| InChIKey | BYYNMXABNXIQEV-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|