C4H8N4OS — CID 19799793
4-amino-3-ethylsulfanyl-1H-1,2,4-triazol-5-one (PubChem CID 19799793) has the molecular formula C4H8N4OS and a molecular weight of 160.20 g/mol. Its IUPAC name is 4-amino-3-ethylsulfanyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-amino-3-ethylsulfanyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 19799793 |
| Molecular Formula | C4H8N4OS |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 4-amino-3-ethylsulfanyl-1H-1,2,4-triazol-5-one |
| SMILES | CCSc1n[nH]c(=O)n1N |
| InChI | InChI=1S/C4H8N4OS/c1-2-10-4-7-6-3(9)8(4)5/h2,5H2,1H3,(H,6,9) |
| InChIKey | VIHFXPWYTFRKCY-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |