C4H7N3OS — CID 137212019
3-ethylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137212019) has the molecular formula C4H7N3OS and a molecular weight of 145.19 g/mol. Its IUPAC name is 3-ethylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-ethylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137212019 |
| Molecular Formula | C4H7N3OS |
| Molecular Weight | 145.19 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | 3-ethylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CCSc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H7N3OS/c1-2-9-4-5-3(8)6-7-4/h2H2,1H3,(H2,5,6,7,8) |
| InChIKey | SNGGXENRPPKZSS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |