C12H9N5O4S — CID 67618442
2-[4-(1H-imidazol-2-ylsulfonyl)-2-nitrophenyl]-1H-imidazole (PubChem CID 67618442) has the molecular formula C12H9N5O4S and a molecular weight of 319.30 g/mol. Its IUPAC name is 2-[4-(1H-imidazol-2-ylsulfonyl)-2-nitrophenyl]-1H-imidazole.
| Compound Name | 2-[4-(1H-imidazol-2-ylsulfonyl)-2-nitrophenyl]-1H-imidazole |
|---|---|
| PubChem CID | 67618442 |
| Molecular Formula | C12H9N5O4S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[4-(1H-imidazol-2-ylsulfonyl)-2-nitrophenyl]-1H-imidazole |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)c2ncc[nH]2)ccc1-c1ncc[nH]1 |
| InChI | InChI=1S/C12H9N5O4S/c18-17(19)10-7-8(22(20,21)12-15-5-6-16-12)1-2-9(10)11-13-3-4-14-11/h1-7H,(H,13,14)(H,15,16) |
| InChIKey | BGALEUBTUQPDTE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|