C17H15N3O4 — CID 67618510
6-[[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]amino]quinoxaline-5,8-dione (PubChem CID 67618510) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 6-[[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]amino]quinoxaline-5,8-dione.
| Compound Name | 6-[[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]amino]quinoxaline-5,8-dione |
|---|---|
| PubChem CID | 67618510 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 6-[[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]amino]quinoxaline-5,8-dione |
| SMILES | O=C1C=C(N[C@H](CO)Cc2ccc(O)cc2)C(=O)c2nccnc21 |
| InChI | InChI=1S/C17H15N3O4/c21-9-11(7-10-1-3-12(22)4-2-10)20-13-8-14(23)15-16(17(13)24)19-6-5-18-15/h1-6,8,11,20-22H,7,9H2/t11-/m0/s1 |
| InChIKey | NPEVAQBZVULEAI-NSHDSACASA-N |
| XLogP | 0.64 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|