C9H11NO4 — CID 67622846
2-ethenyl-6-methoxy-6-nitrocyclohexa-2,4-dien-1-ol (PubChem CID 67622846) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-ethenyl-6-methoxy-6-nitrocyclohexa-2,4-dien-1-ol.
| Compound Name | 2-ethenyl-6-methoxy-6-nitrocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 67622846 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-ethenyl-6-methoxy-6-nitrocyclohexa-2,4-dien-1-ol |
| SMILES | C=CC1=CC=CC(OC)([N+](=O)[O-])C1O |
| InChI | InChI=1S/C9H11NO4/c1-3-7-5-4-6-9(14-2,8(7)11)10(12)13/h3-6,8,11H,1H2,2H3 |
| InChIKey | XNSHETTUPFLVDI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|