C26H27N5O5 — CID 67623521
2-[1-[4-[2-[4-[(3-nitrophenyl)methyl]-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]ethyl]guanidine (PubChem CID 67623521) has the molecular formula C26H27N5O5 and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-[1-[4-[2-[4-[(3-nitrophenyl)methyl]-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]ethyl]guanidine.
| Compound Name | 2-[1-[4-[2-[4-[(3-nitrophenyl)methyl]-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 67623521 |
| Molecular Formula | C26H27N5O5 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-[1-[4-[2-[4-[(3-nitrophenyl)methyl]-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]ethyl]guanidine |
| SMILES | CC(N=C(N)N)c1ccc(OCCC2Oc3ccccc3N(Cc3cccc([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C26H27N5O5/c1-17(29-26(27)28)19-9-11-21(12-10-19)35-14-13-24-25(32)30(22-7-2-3-8-23(22)36-24)16-18-5-4-6-20(15-18)31(33)34/h2-12,15,17,24H,13-14,16H2,1H3,(H4,27,28,29) |
| InChIKey | GYWCZWQMNZEHIP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 146.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|