C36H42N6O11 — CID 154350767
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[2-[4-[2-[7-nitro-4-[(4-nitrophenyl)methyl]-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]ethyl]carbamate (PubChem CID 154350767) has the molecular formula C36H42N6O11 and a molecular weight of 734.76 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[2-[4-[2-[7-nitro-4-[(4-nitrophenyl)methyl]-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[2-[4-[2-[7-nitro-4-[(4-nitrophenyl)methyl]-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 154350767 |
| Molecular Formula | C36H42N6O11 |
| Molecular Weight | 734.76 g/mol |
| Exact Mass | 734.29 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[2-[4-[2-[7-nitro-4-[(4-nitrophenyl)methyl]-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]ethyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(CCc1ccc(OCCC2Oc3cc([N+](=O)[O-])ccc3N(Cc3ccc([N+](=O)[O-])cc3)C2=O)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H42N6O11/c1-35(2,3)52-33(44)38-32(37)39(34(45)53-36(4,5)6)19-17-23-9-14-27(15-10-23)50-20-18-29-31(43)40(22-24-7-11-25(12-8-24)41(46)47)28-16-13-26(42(48)49)21-30(28)51-29/h7-16,21,29H,17-20,22H2,1-6H3,(H2,37,38,44) |
| InChIKey | MMQAIAGSZFXZCR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 216.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.76 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|