C26H30N2O5 — CID 67627939
(Z)-4-(1-benzylpiperidin-4-yl)oxy-4-oxobut-2-enoic acid;3-propyl-1,2-benzoxazole (PubChem CID 67627939) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is (Z)-4-(1-benzylpiperidin-4-yl)oxy-4-oxobut-2-enoic acid;3-propyl-1,2-benzoxazole.
| Compound Name | (Z)-4-(1-benzylpiperidin-4-yl)oxy-4-oxobut-2-enoic acid;3-propyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 67627939 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (Z)-4-(1-benzylpiperidin-4-yl)oxy-4-oxobut-2-enoic acid;3-propyl-1,2-benzoxazole |
| SMILES | CCCc1noc2ccccc12.O=C(O)/C=C\C(=O)OC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H19NO4.C10H11NO/c18-15(19)6-7-16(20)21-14-8-10-17(11-9-14)12-13-4-2-1-3-5-13;1-2-5-9-8-6-3-4-7-10(8)12-11-9/h1-7,14H,8-12H2,(H,18,19);3-4,6-7H,2,5H2,1H3/b7-6-; |
| InChIKey | AGOZMYCOOMKRFR-NAFXZHHSSA-N |
| XLogP | 4.62 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|