C25H28N2O5 — CID 67628519
4-(1-benzylpiperidin-4-yl)-3-ethyl-1,2-benzoxazole;(Z)-but-2-enedioic acid (PubChem CID 67628519) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-(1-benzylpiperidin-4-yl)-3-ethyl-1,2-benzoxazole;(Z)-but-2-enedioic acid.
| Compound Name | 4-(1-benzylpiperidin-4-yl)-3-ethyl-1,2-benzoxazole;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 67628519 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-(1-benzylpiperidin-4-yl)-3-ethyl-1,2-benzoxazole;(Z)-but-2-enedioic acid |
| SMILES | CCc1noc2cccc(C3CCN(Cc4ccccc4)CC3)c12.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H24N2O.C4H4O4/c1-2-19-21-18(9-6-10-20(21)24-22-19)17-11-13-23(14-12-17)15-16-7-4-3-5-8-16;5-3(6)1-2-4(7)8/h3-10,17H,2,11-15H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SLWKKNBMKRUEGD-BTJKTKAUSA-N |
| XLogP | 4.48 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|