C30H42N2O8 — CID 67640429
methyl 3-ethoxy-4-[[N-[(2-methylpropan-2-yl)oxycarbonyl]-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]anilino]methyl]benzoate (PubChem CID 67640429) has the molecular formula C30H42N2O8 and a molecular weight of 558.67 g/mol. Its IUPAC name is methyl 3-ethoxy-4-[[N-[(2-methylpropan-2-yl)oxycarbonyl]-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]anilino]methyl]benzoate.
| Compound Name | methyl 3-ethoxy-4-[[N-[(2-methylpropan-2-yl)oxycarbonyl]-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]anilino]methyl]benzoate |
|---|---|
| PubChem CID | 67640429 |
| Molecular Formula | C30H42N2O8 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | methyl 3-ethoxy-4-[[N-[(2-methylpropan-2-yl)oxycarbonyl]-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]anilino]methyl]benzoate |
| SMILES | CCOc1cc(C(=O)OC)ccc1CN(C(=O)OC(C)(C)C)c1ccccc1OCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H42N2O8/c1-9-37-25-19-21(26(33)36-8)15-16-22(25)20-32(28(35)40-30(5,6)7)23-13-10-11-14-24(23)38-18-12-17-31-27(34)39-29(2,3)4/h10-11,13-16,19H,9,12,17-18,20H2,1-8H3,(H,31,34) |
| InChIKey | SXHSXXRGBPPMLV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|