C18H19ClIN3O — CID 67642834
1-(7-chloroquinolin-4-yl)-2-N-(furan-2-ylmethyl)-1-iodo-2-methylpropane-1,2-diamine (PubChem CID 67642834) has the molecular formula C18H19ClIN3O and a molecular weight of 455.73 g/mol. Its IUPAC name is 1-(7-chloroquinolin-4-yl)-2-N-(furan-2-ylmethyl)-1-iodo-2-methylpropane-1,2-diamine.
| Compound Name | 1-(7-chloroquinolin-4-yl)-2-N-(furan-2-ylmethyl)-1-iodo-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 67642834 |
| Molecular Formula | C18H19ClIN3O |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 1-(7-chloroquinolin-4-yl)-2-N-(furan-2-ylmethyl)-1-iodo-2-methylpropane-1,2-diamine |
| SMILES | CC(C)(NCc1ccco1)C(N)(I)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H19ClIN3O/c1-17(2,23-11-13-4-3-9-24-13)18(20,21)15-7-8-22-16-10-12(19)5-6-14(15)16/h3-10,23H,11,21H2,1-2H3 |
| InChIKey | CWJYBSXFTIKNJT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|