C21H25Cl3IN3O2 — CID 67619442
2-[[[1-amino-1-(7-chloroquinolin-4-yl)-1-iodo-2-methylpropan-2-yl]amino]methyl]-6-methoxyphenol;dihydrochloride (PubChem CID 67619442) has the molecular formula C21H25Cl3IN3O2 and a molecular weight of 584.71 g/mol. Its IUPAC name is 2-[[[1-amino-1-(7-chloroquinolin-4-yl)-1-iodo-2-methylpropan-2-yl]amino]methyl]-6-methoxyphenol;dihydrochloride.
| Compound Name | 2-[[[1-amino-1-(7-chloroquinolin-4-yl)-1-iodo-2-methylpropan-2-yl]amino]methyl]-6-methoxyphenol;dihydrochloride |
|---|---|
| PubChem CID | 67619442 |
| Molecular Formula | C21H25Cl3IN3O2 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 583.01 |
| IUPAC Name | 2-[[[1-amino-1-(7-chloroquinolin-4-yl)-1-iodo-2-methylpropan-2-yl]amino]methyl]-6-methoxyphenol;dihydrochloride |
| SMILES | COc1cccc(CNC(C)(C)C(N)(I)c2ccnc3cc(Cl)ccc23)c1O.Cl.Cl |
| InChI | InChI=1S/C21H23ClIN3O2.2ClH/c1-20(2,26-12-13-5-4-6-18(28-3)19(13)27)21(23,24)16-9-10-25-17-11-14(22)7-8-15(16)17;;/h4-11,26-27H,12,24H2,1-3H3;2*1H |
| InChIKey | WNRDAXDIVFRKQT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|