C26H32O4 — CID 67645384
methyl 3-(3,5-ditert-butyl-4-methoxyphenyl)-2H-chromene-7-carboxylate (PubChem CID 67645384) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is methyl 3-(3,5-ditert-butyl-4-methoxyphenyl)-2H-chromene-7-carboxylate.
| Compound Name | methyl 3-(3,5-ditert-butyl-4-methoxyphenyl)-2H-chromene-7-carboxylate |
|---|---|
| PubChem CID | 67645384 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | methyl 3-(3,5-ditert-butyl-4-methoxyphenyl)-2H-chromene-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)OCC(c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1)=C2 |
| InChI | InChI=1S/C26H32O4/c1-25(2,3)20-12-18(13-21(23(20)28-7)26(4,5)6)19-11-16-9-10-17(24(27)29-8)14-22(16)30-15-19/h9-14H,15H2,1-8H3 |
| InChIKey | IEKAZUYVWPFISX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|