C36H32F2N4O3 — CID 67658326
3-[4,4-difluoro-5-(2-oxo-2-piperazin-1-ylethylidene)-2,3-dihydro-1-benzazepine-1-carbonyl]-N,2-diphenylbenzamide (PubChem CID 67658326) has the molecular formula C36H32F2N4O3 and a molecular weight of 606.67 g/mol. Its IUPAC name is 3-[4,4-difluoro-5-(2-oxo-2-piperazin-1-ylethylidene)-2,3-dihydro-1-benzazepine-1-carbonyl]-N,2-diphenylbenzamide.
| Compound Name | 3-[4,4-difluoro-5-(2-oxo-2-piperazin-1-ylethylidene)-2,3-dihydro-1-benzazepine-1-carbonyl]-N,2-diphenylbenzamide |
|---|---|
| PubChem CID | 67658326 |
| Molecular Formula | C36H32F2N4O3 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | 3-[4,4-difluoro-5-(2-oxo-2-piperazin-1-ylethylidene)-2,3-dihydro-1-benzazepine-1-carbonyl]-N,2-diphenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(C(=O)N2CCC(F)(F)C(=CC(=O)N3CCNCC3)c3ccccc32)c1-c1ccccc1 |
| InChI | InChI=1S/C36H32F2N4O3/c37-36(38)18-21-42(31-17-8-7-14-27(31)30(36)24-32(43)41-22-19-39-20-23-41)35(45)29-16-9-15-28(33(29)25-10-3-1-4-11-25)34(44)40-26-12-5-2-6-13-26/h1-17,24,39H,18-23H2,(H,40,44) |
| InChIKey | GPPLVFLSKAGRQK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|