C35H31F2N3O3 — CID 67658420
3-[4,4-difluoro-5-[2-oxo-2-(propan-2-ylamino)ethylidene]-2,3-dihydro-1-benzazepine-1-carbonyl]-N,2-diphenylbenzamide (PubChem CID 67658420) has the molecular formula C35H31F2N3O3 and a molecular weight of 579.65 g/mol. Its IUPAC name is 3-[4,4-difluoro-5-[2-oxo-2-(propan-2-ylamino)ethylidene]-2,3-dihydro-1-benzazepine-1-carbonyl]-N,2-diphenylbenzamide.
| Compound Name | 3-[4,4-difluoro-5-[2-oxo-2-(propan-2-ylamino)ethylidene]-2,3-dihydro-1-benzazepine-1-carbonyl]-N,2-diphenylbenzamide |
|---|---|
| PubChem CID | 67658420 |
| Molecular Formula | C35H31F2N3O3 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 3-[4,4-difluoro-5-[2-oxo-2-(propan-2-ylamino)ethylidene]-2,3-dihydro-1-benzazepine-1-carbonyl]-N,2-diphenylbenzamide |
| SMILES | CC(C)NC(=O)C=C1c2ccccc2N(C(=O)c2cccc(C(=O)Nc3ccccc3)c2-c2ccccc2)CCC1(F)F |
| InChI | InChI=1S/C35H31F2N3O3/c1-23(2)38-31(41)22-29-26-16-9-10-19-30(26)40(21-20-35(29,36)37)34(43)28-18-11-17-27(32(28)24-12-5-3-6-13-24)33(42)39-25-14-7-4-8-15-25/h3-19,22-23H,20-21H2,1-2H3,(H,38,41)(H,39,42) |
| InChIKey | JYHGSEYSQBEXFE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|