C36H34F2N4O4 — CID 67658434
2-(2,5-dimethylpyrrol-1-yl)-3-[5-[2,3-dioxo-3-(propan-2-ylamino)propylidene]-4,4-difluoro-2,3-dihydro-1-benzazepine-1-carbonyl]-N-phenylbenzamide (PubChem CID 67658434) has the molecular formula C36H34F2N4O4 and a molecular weight of 624.69 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-3-[5-[2,3-dioxo-3-(propan-2-ylamino)propylidene]-4,4-difluoro-2,3-dihydro-1-benzazepine-1-carbonyl]-N-phenylbenzamide.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-3-[5-[2,3-dioxo-3-(propan-2-ylamino)propylidene]-4,4-difluoro-2,3-dihydro-1-benzazepine-1-carbonyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 67658434 |
| Molecular Formula | C36H34F2N4O4 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-3-[5-[2,3-dioxo-3-(propan-2-ylamino)propylidene]-4,4-difluoro-2,3-dihydro-1-benzazepine-1-carbonyl]-N-phenylbenzamide |
| SMILES | Cc1ccc(C)n1-c1c(C(=O)Nc2ccccc2)cccc1C(=O)N1CCC(F)(F)C(=CC(=O)C(=O)NC(C)C)c2ccccc21 |
| InChI | InChI=1S/C36H34F2N4O4/c1-22(2)39-34(45)31(43)21-29-26-13-8-9-16-30(26)41(20-19-36(29,37)38)35(46)28-15-10-14-27(32(28)42-23(3)17-18-24(42)4)33(44)40-25-11-6-5-7-12-25/h5-18,21-22H,19-20H2,1-4H3,(H,39,45)(H,40,44) |
| InChIKey | DEWZDAFGSWVPNQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|